About penta-1,4-dien-3-ylbenzene
penta-1,4-dien-3-ylbenzene (PubChem CID 15879286) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is penta-1,4-dien-3-ylbenzene.
Molecular Properties
| Compound Name | penta-1,4-dien-3-ylbenzene |
| PubChem CID | 15879286 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | penta-1,4-dien-3-ylbenzene |
| SMILES | C=CC(C=C)c1ccccc1 |
| InChI | InChI=1S/C11H12/c1-3-10(4-2)11-8-6-5-7-9-11/h3-10H,1-2H2 |
| InChIKey | DBSDMAPJGHBWAL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze penta-1,4-dien-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,4-dien-3-ylbenzene?
The IUPAC name of penta-1,4-dien-3-ylbenzene (CID 15879286) is penta-1,4-dien-3-ylbenzene.
What is the SMILES notation for penta-1,4-dien-3-ylbenzene?
The canonical SMILES for penta-1,4-dien-3-ylbenzene is C=CC(C=C)c1ccccc1.
What is the InChIKey of penta-1,4-dien-3-ylbenzene?
The InChIKey is DBSDMAPJGHBWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-3-10(4-2)11-8-6-5-7-9-11/h3-10H,1-2H2.
What are the key properties of penta-1,4-dien-3-ylbenzene?
penta-1,4-dien-3-ylbenzene has a molecular weight of 144.22 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,4-dien-3-ylbenzene is sourced from PubChem (CID 15879286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).