C12H14O — CID 15767643
(2E)-4-phenylhexa-2,5-dien-1-ol (PubChem CID 15767643) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (2E)-4-phenylhexa-2,5-dien-1-ol.
| Compound Name | (2E)-4-phenylhexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 15767643 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2E)-4-phenylhexa-2,5-dien-1-ol |
| SMILES | C=CC(/C=C/CO)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-2-11(9-6-10-13)12-7-4-3-5-8-12/h2-9,11,13H,1,10H2/b9-6+ |
| InChIKey | AFXATSGOIAVPTH-RMKNXTFCSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|