C10H12O3 — CID 57216161
1-phenoxybut-2-ene-1,4-diol (PubChem CID 57216161) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-phenoxybut-2-ene-1,4-diol.
| Compound Name | 1-phenoxybut-2-ene-1,4-diol |
|---|---|
| PubChem CID | 57216161 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-phenoxybut-2-ene-1,4-diol |
| SMILES | OCC=CC(O)Oc1ccccc1 |
| InChI | InChI=1S/C10H12O3/c11-8-4-7-10(12)13-9-5-2-1-3-6-9/h1-7,10-12H,8H2 |
| InChIKey | FWBMTBAZNJETET-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|