C22H26O4 — CID 6393557
(2E,6E)-4,5-bis(phenylmethoxy)octa-2,6-diene-1,8-diol (PubChem CID 6393557) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2E,6E)-4,5-bis(phenylmethoxy)octa-2,6-diene-1,8-diol.
| Compound Name | (2E,6E)-4,5-bis(phenylmethoxy)octa-2,6-diene-1,8-diol |
|---|---|
| PubChem CID | 6393557 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2E,6E)-4,5-bis(phenylmethoxy)octa-2,6-diene-1,8-diol |
| SMILES | OC/C=C/C(OCc1ccccc1)C(/C=C/CO)OCc1ccccc1 |
| InChI | InChI=1S/C22H26O4/c23-15-7-13-21(25-17-19-9-3-1-4-10-19)22(14-8-16-24)26-18-20-11-5-2-6-12-20/h1-14,21-24H,15-18H2/b13-7+,14-8+ |
| InChIKey | FNXJSYYICOKACB-FNCQTZNRSA-N |
| XLogP | 3.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|