C22H28O5 — CID 135036464
(E,4S,5R)-5-(methoxymethoxy)-4,6-bis(phenylmethoxy)hex-2-en-1-ol (PubChem CID 135036464) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (E,4S,5R)-5-(methoxymethoxy)-4,6-bis(phenylmethoxy)hex-2-en-1-ol.
| Compound Name | (E,4S,5R)-5-(methoxymethoxy)-4,6-bis(phenylmethoxy)hex-2-en-1-ol |
|---|---|
| PubChem CID | 135036464 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (E,4S,5R)-5-(methoxymethoxy)-4,6-bis(phenylmethoxy)hex-2-en-1-ol |
| SMILES | COCO[C@H](COCc1ccccc1)[C@H](/C=C/CO)OCc1ccccc1 |
| InChI | InChI=1S/C22H28O5/c1-24-18-27-22(17-25-15-19-9-4-2-5-10-19)21(13-8-14-23)26-16-20-11-6-3-7-12-20/h2-13,21-23H,14-18H2,1H3/b13-8+/t21-,22+/m0/s1 |
| InChIKey | PVQXIZLCJHSDHY-GTGIDHPJSA-N |
| XLogP | 3.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|