C20H34O3Si — CID 15396344
(E,4R,5S)-4-methyl-6-phenylmethoxy-5-triethylsilyloxyhex-2-en-1-ol (PubChem CID 15396344) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (E,4R,5S)-4-methyl-6-phenylmethoxy-5-triethylsilyloxyhex-2-en-1-ol.
| Compound Name | (E,4R,5S)-4-methyl-6-phenylmethoxy-5-triethylsilyloxyhex-2-en-1-ol |
|---|---|
| PubChem CID | 15396344 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (E,4R,5S)-4-methyl-6-phenylmethoxy-5-triethylsilyloxyhex-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](COCc1ccccc1)[C@H](C)/C=C/CO |
| InChI | InChI=1S/C20H34O3Si/c1-5-24(6-2,7-3)23-20(18(4)12-11-15-21)17-22-16-19-13-9-8-10-14-19/h8-14,18,20-21H,5-7,15-17H2,1-4H3/b12-11+/t18-,20-/m1/s1 |
| InChIKey | OGHNVIBSCPZLAG-KALAYHLKSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|