C23H40O3Si — CID 15396349
(E,4S,5R,6S)-2,4,6-trimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol (PubChem CID 15396349) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (E,4S,5R,6S)-2,4,6-trimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol.
| Compound Name | (E,4S,5R,6S)-2,4,6-trimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol |
|---|---|
| PubChem CID | 15396349 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (E,4S,5R,6S)-2,4,6-trimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)/C=C(\C)CO)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C23H40O3Si/c1-7-27(8-2,9-3)26-23(20(5)15-19(4)16-24)21(6)17-25-18-22-13-11-10-12-14-22/h10-15,20-21,23-24H,7-9,16-18H2,1-6H3/b19-15+/t20-,21-,23+/m0/s1 |
| InChIKey | ONWONYGTTYOHIH-WJBLZDQBSA-N |
| XLogP | 5.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|