C14H20O3 — CID 10513984
4-methyl-2-methylidene-5-phenylmethoxypentane-1,3-diol (PubChem CID 10513984) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-methyl-2-methylidene-5-phenylmethoxypentane-1,3-diol.
| Compound Name | 4-methyl-2-methylidene-5-phenylmethoxypentane-1,3-diol |
|---|---|
| PubChem CID | 10513984 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-methyl-2-methylidene-5-phenylmethoxypentane-1,3-diol |
| SMILES | C=C(CO)C(O)C(C)COCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-11(8-15)14(16)12(2)9-17-10-13-6-4-3-5-7-13/h3-7,12,14-16H,1,8-10H2,2H3 |
| InChIKey | VOENPDUFKAFOGY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|