C17H26O3 — CID 23247704
(3S,4R,5R,6R)-2,4,6-trimethyl-7-phenylmethoxyhept-1-ene-3,5-diol (PubChem CID 23247704) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3S,4R,5R,6R)-2,4,6-trimethyl-7-phenylmethoxyhept-1-ene-3,5-diol.
| Compound Name | (3S,4R,5R,6R)-2,4,6-trimethyl-7-phenylmethoxyhept-1-ene-3,5-diol |
|---|---|
| PubChem CID | 23247704 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3S,4R,5R,6R)-2,4,6-trimethyl-7-phenylmethoxyhept-1-ene-3,5-diol |
| SMILES | C=C(C)[C@@H](O)[C@H](C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-12(2)16(18)14(4)17(19)13(3)10-20-11-15-8-6-5-7-9-15/h5-9,13-14,16-19H,1,10-11H2,2-4H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | YVGPSIQUUQXXQV-YALNPMBYSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|