C13H20O3 — CID 101210751
(3R,4R)-4-methyl-5-phenylmethoxypentane-1,3-diol (PubChem CID 101210751) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3R,4R)-4-methyl-5-phenylmethoxypentane-1,3-diol.
| Compound Name | (3R,4R)-4-methyl-5-phenylmethoxypentane-1,3-diol |
|---|---|
| PubChem CID | 101210751 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3R,4R)-4-methyl-5-phenylmethoxypentane-1,3-diol |
| SMILES | C[C@H](COCc1ccccc1)[C@H](O)CCO |
| InChI | InChI=1S/C13H20O3/c1-11(13(15)7-8-14)9-16-10-12-5-3-2-4-6-12/h2-6,11,13-15H,7-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | AYELXLZXGROWSI-DGCLKSJQSA-N |
| XLogP | 1.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |