C19H32O4 — CID 102077009
(3S,4S,5S,6R)-4,6-dimethyl-10-phenylmethoxydecane-1,3,5-triol (PubChem CID 102077009) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (3S,4S,5S,6R)-4,6-dimethyl-10-phenylmethoxydecane-1,3,5-triol.
| Compound Name | (3S,4S,5S,6R)-4,6-dimethyl-10-phenylmethoxydecane-1,3,5-triol |
|---|---|
| PubChem CID | 102077009 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (3S,4S,5S,6R)-4,6-dimethyl-10-phenylmethoxydecane-1,3,5-triol |
| SMILES | C[C@H]([C@@H](O)[C@H](C)CCCCOCc1ccccc1)[C@@H](O)CCO |
| InChI | InChI=1S/C19H32O4/c1-15(19(22)16(2)18(21)11-12-20)8-6-7-13-23-14-17-9-4-3-5-10-17/h3-5,9-10,15-16,18-22H,6-8,11-14H2,1-2H3/t15-,16+,18+,19+/m1/s1 |
| InChIKey | JQOSOMPZTCSXHR-NEPXVJNWSA-N |
| XLogP | 2.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|