C22H36O4 — CID 142001538
(6R,8S)-1,7-dihydroxy-4,4,6,8-tetramethyl-11-phenylmethoxyundecan-5-one (PubChem CID 142001538) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (6R,8S)-1,7-dihydroxy-4,4,6,8-tetramethyl-11-phenylmethoxyundecan-5-one.
| Compound Name | (6R,8S)-1,7-dihydroxy-4,4,6,8-tetramethyl-11-phenylmethoxyundecan-5-one |
|---|---|
| PubChem CID | 142001538 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (6R,8S)-1,7-dihydroxy-4,4,6,8-tetramethyl-11-phenylmethoxyundecan-5-one |
| SMILES | C[C@@H](CCCOCc1ccccc1)C(O)[C@@H](C)C(=O)C(C)(C)CCCO |
| InChI | InChI=1S/C22H36O4/c1-17(10-8-15-26-16-19-11-6-5-7-12-19)20(24)18(2)21(25)22(3,4)13-9-14-23/h5-7,11-12,17-18,20,23-24H,8-10,13-16H2,1-4H3/t17-,18+,20?/m0/s1 |
| InChIKey | DTYQACRPYODFOA-IVAAQHKWSA-N |
| XLogP | 3.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|