C29H50O4Si — CID 67268331
(4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-12-phenylmethoxydodec-1-en-6-one (PubChem CID 67268331) has the molecular formula C29H50O4Si and a molecular weight of 490.80 g/mol. Its IUPAC name is (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-12-phenylmethoxydodec-1-en-6-one.
| Compound Name | (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-12-phenylmethoxydodec-1-en-6-one |
|---|---|
| PubChem CID | 67268331 |
| Molecular Formula | C29H50O4Si |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | (4S,7R,8S,9S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-5,5,7,9-tetramethyl-12-phenylmethoxydodec-1-en-6-one |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCCOCc1ccccc1 |
| InChI | InChI=1S/C29H50O4Si/c1-11-16-25(33-34(9,10)28(4,5)6)29(7,8)27(31)23(3)26(30)22(2)17-15-20-32-21-24-18-13-12-14-19-24/h11-14,18-19,22-23,25-26,30H,1,15-17,20-21H2,2-10H3/t22-,23+,25-,26-/m0/s1 |
| InChIKey | VRBUQTZTGRAVIT-AYEHBTSNSA-N |
| XLogP | 7.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|