C37H62O3Si — CID 66710987
1,17-bis(phenylmethoxy)heptadecan-9-yloxy-tert-butyl-dimethylsilane (PubChem CID 66710987) has the molecular formula C37H62O3Si and a molecular weight of 582.99 g/mol. Its IUPAC name is 1,17-bis(phenylmethoxy)heptadecan-9-yloxy-tert-butyl-dimethylsilane.
| Compound Name | 1,17-bis(phenylmethoxy)heptadecan-9-yloxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 66710987 |
| Molecular Formula | C37H62O3Si |
| Molecular Weight | 582.99 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | 1,17-bis(phenylmethoxy)heptadecan-9-yloxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCCCCCOCc1ccccc1)CCCCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C37H62O3Si/c1-37(2,3)41(4,5)40-36(28-20-10-6-8-12-22-30-38-32-34-24-16-14-17-25-34)29-21-11-7-9-13-23-31-39-33-35-26-18-15-19-27-35/h14-19,24-27,36H,6-13,20-23,28-33H2,1-5H3 |
| InChIKey | WRMVGNYXAMPFEE-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.99 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|