C20H34O4Si — CID 11222352
ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentanoate (PubChem CID 11222352) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentanoate.
| Compound Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 11222352 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxypentanoate |
| SMILES | CCOC(=O)C[C@@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-7-23-19(21)15-18(24-25(5,6)20(2,3)4)13-14-22-16-17-11-9-8-10-12-17/h8-12,18H,7,13-16H2,1-6H3/t18-/m1/s1 |
| InChIKey | QQXKAXJBWJOCAX-GOSISDBHSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|