C17H27BrO3Si — CID 141383140
benzyl (3S)-4-bromo-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 141383140) has the molecular formula C17H27BrO3Si and a molecular weight of 387.39 g/mol. Its IUPAC name is benzyl (3S)-4-bromo-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | benzyl (3S)-4-bromo-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 141383140 |
| Molecular Formula | C17H27BrO3Si |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | benzyl (3S)-4-bromo-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CBr)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H27BrO3Si/c1-17(2,3)22(4,5)21-15(12-18)11-16(19)20-13-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | OVRKLYBTRHJHOB-HNNXBMFYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|