About benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde
benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde (PubChem CID 159883415) has the molecular formula C23H34O6
and a molecular weight of 406.52 g/mol. Its IUPAC name is benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde.
Molecular Properties
| Compound Name | benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde |
| PubChem CID | 159883415 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde |
| SMILES | C=O.C=O.CC.CC.O=C(CC(Cc1ccccc1)OO)OCc1ccccc1 |
| InChI | InChI=1S/C17H18O4.2C2H6.2CH2O/c18-17(20-13-15-9-5-2-6-10-15)12-16(21-19)11-14-7-3-1-4-8-14;4*1-2/h1-10,16,19H,11-13H2;2*1-2H3;2*1H2 |
| InChIKey | NTVAUWCAKBNKRE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde?
The IUPAC name of benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde (CID 159883415) is benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde.
What is the SMILES notation for benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde?
The canonical SMILES for benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde is C=O.C=O.CC.CC.O=C(CC(Cc1ccccc1)OO)OCc1ccccc1.
What is the InChIKey of benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde?
The InChIKey is NTVAUWCAKBNKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4.2C2H6.2CH2O/c18-17(20-13-15-9-5-2-6-10-15)12-16(21-19)11-14-7-3-1-4-8-14;4*1-2/h1-10,16,19H,11-13H2;2*1-2H3;2*1H2.
What are the key properties of benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde?
benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde has a molecular weight of 406.52 g/mol, XLogP of 4.90, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-hydroperoxy-4-phenylbutanoate;ethane;formaldehyde is sourced from PubChem (CID 159883415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).