C21H34O5Si — CID 10786824
1-O-benzyl 4-O-tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate (PubChem CID 10786824) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
|---|---|
| PubChem CID | 10786824 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H34O5Si/c1-20(2,3)25-18(22)14-17(26-27(7,8)21(4,5)6)19(23)24-15-16-12-10-9-11-13-16/h9-13,17H,14-15H2,1-8H3/t17-/m0/s1 |
| InChIKey | DYVWALHCUTVBGE-KRWDZBQOSA-N |
| XLogP | 4.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|