C29H33NO4 — CID 22956966
1-O-benzyl 4-O-tert-butyl 2-(dibenzylamino)butanedioate (PubChem CID 22956966) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl 2-(dibenzylamino)butanedioate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl 2-(dibenzylamino)butanedioate |
|---|---|
| PubChem CID | 22956966 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl 2-(dibenzylamino)butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H33NO4/c1-29(2,3)34-27(31)19-26(28(32)33-22-25-17-11-6-12-18-25)30(20-23-13-7-4-8-14-23)21-24-15-9-5-10-16-24/h4-18,26H,19-22H2,1-3H3 |
| InChIKey | KGMQDROPHYXNNQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |