C24H31NO3 — CID 102383366
ethyl 2-(dibenzylamino)-5,5-dimethyl-4-oxohexanoate (PubChem CID 102383366) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-5,5-dimethyl-4-oxohexanoate.
| Compound Name | ethyl 2-(dibenzylamino)-5,5-dimethyl-4-oxohexanoate |
|---|---|
| PubChem CID | 102383366 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | ethyl 2-(dibenzylamino)-5,5-dimethyl-4-oxohexanoate |
| SMILES | CCOC(=O)C(CC(=O)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c1-5-28-23(27)21(16-22(26)24(2,3)4)25(17-19-12-8-6-9-13-19)18-20-14-10-7-11-15-20/h6-15,21H,5,16-18H2,1-4H3 |
| InChIKey | ZEBPTBDKNKBJJT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |