C20H23F2NO3 — CID 15673911
ethyl 2-(dibenzylamino)-4,4-difluoro-3-hydroxybutanoate (PubChem CID 15673911) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-4,4-difluoro-3-hydroxybutanoate.
| Compound Name | ethyl 2-(dibenzylamino)-4,4-difluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 15673911 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | ethyl 2-(dibenzylamino)-4,4-difluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(C(O)C(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H23F2NO3/c1-2-26-20(25)17(18(24)19(21)22)23(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12,17-19,24H,2,13-14H2,1H3 |
| InChIKey | SIPBKLVGIPRFKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |