C24H24FNO3 — CID 101112778
methyl (2R,3S)-2-(dibenzylamino)-3-(2-fluorophenyl)-3-hydroxypropanoate (PubChem CID 101112778) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is methyl (2R,3S)-2-(dibenzylamino)-3-(2-fluorophenyl)-3-hydroxypropanoate.
| Compound Name | methyl (2R,3S)-2-(dibenzylamino)-3-(2-fluorophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 101112778 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl (2R,3S)-2-(dibenzylamino)-3-(2-fluorophenyl)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H]([C@@H](O)c1ccccc1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24FNO3/c1-29-24(28)22(23(27)20-14-8-9-15-21(20)25)26(16-18-10-4-2-5-11-18)17-19-12-6-3-7-13-19/h2-15,22-23,27H,16-17H2,1H3/t22-,23+/m1/s1 |
| InChIKey | MFHFWKRYPWYPDP-PKTZIBPZSA-N |
| XLogP | 4.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |