C33H33NO4 — CID 102288972
methyl (2S,3S)-2-(dibenzylamino)-3-(4-methoxyphenyl)-5-oxo-5-phenylpentanoate (PubChem CID 102288972) has the molecular formula C33H33NO4 and a molecular weight of 507.63 g/mol. Its IUPAC name is methyl (2S,3S)-2-(dibenzylamino)-3-(4-methoxyphenyl)-5-oxo-5-phenylpentanoate.
| Compound Name | methyl (2S,3S)-2-(dibenzylamino)-3-(4-methoxyphenyl)-5-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 102288972 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | methyl (2S,3S)-2-(dibenzylamino)-3-(4-methoxyphenyl)-5-oxo-5-phenylpentanoate |
| SMILES | COC(=O)[C@H]([C@@H](CC(=O)c1ccccc1)c1ccc(OC)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H33NO4/c1-37-29-20-18-27(19-21-29)30(22-31(35)28-16-10-5-11-17-28)32(33(36)38-2)34(23-25-12-6-3-7-13-25)24-26-14-8-4-9-15-26/h3-21,30,32H,22-24H2,1-2H3/t30-,32-/m0/s1 |
| InChIKey | QVENCTRKLRGIJM-CDZUIXILSA-N |
| XLogP | 6.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |