C17H15F3O2 — CID 71421950
4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one (PubChem CID 71421950) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 71421950 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4,4,4-trifluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O2/c1-22-14-9-7-12(8-10-14)15(17(18,19)20)11-16(21)13-5-3-2-4-6-13/h2-10,15H,11H2,1H3 |
| InChIKey | XEKFSIQAFBSKKL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |