C23H26O6 — CID 97304069
diethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxo-3-phenylpropyl]propanedioate (PubChem CID 97304069) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is diethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxo-3-phenylpropyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxo-3-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 97304069 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | diethyl 2-[(1R)-1-(4-methoxyphenyl)-3-oxo-3-phenylpropyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](CC(=O)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H26O6/c1-4-28-22(25)21(23(26)29-5-2)19(16-11-13-18(27-3)14-12-16)15-20(24)17-9-7-6-8-10-17/h6-14,19,21H,4-5,15H2,1-3H3/t19-/m0/s1 |
| InChIKey | JDAIVLFIGNHSJE-IBGZPJMESA-N |
| XLogP | 3.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|