C28H29NO4 — CID 70677493
ethyl 5-oxo-3,5-diphenyl-2-[[(1S)-1-phenylethyl]carbamoyl]pentanoate (PubChem CID 70677493) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl 5-oxo-3,5-diphenyl-2-[[(1S)-1-phenylethyl]carbamoyl]pentanoate.
| Compound Name | ethyl 5-oxo-3,5-diphenyl-2-[[(1S)-1-phenylethyl]carbamoyl]pentanoate |
|---|---|
| PubChem CID | 70677493 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl 5-oxo-3,5-diphenyl-2-[[(1S)-1-phenylethyl]carbamoyl]pentanoate |
| SMILES | CCOC(=O)C(C(=O)N[C@@H](C)c1ccccc1)C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c1-3-33-28(32)26(27(31)29-20(2)21-13-7-4-8-14-21)24(22-15-9-5-10-16-22)19-25(30)23-17-11-6-12-18-23/h4-18,20,24,26H,3,19H2,1-2H3,(H,29,31)/t20-,24?,26?/m0/s1 |
| InChIKey | KDKPRPKLNDTQRB-IGDXQIGKSA-N |
| XLogP | 5.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|