C13H18N2O3 — CID 104877608
ethyl 2-amino-3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate (PubChem CID 104877608) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl 2-amino-3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate.
| Compound Name | ethyl 2-amino-3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate |
|---|---|
| PubChem CID | 104877608 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethyl 2-amino-3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate |
| SMILES | CCOC(=O)C(N)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-3-18-13(17)11(14)12(16)15-9(2)10-7-5-4-6-8-10/h4-9,11H,3,14H2,1-2H3,(H,15,16)/t9-,11?/m1/s1 |
| InChIKey | YLWHRGKKERYBAM-BFHBGLAWSA-N |
| XLogP | 0.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|