C22H22F2O5 — CID 101413948
diethyl 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]propanedioate (PubChem CID 101413948) has the molecular formula C22H22F2O5 and a molecular weight of 404.41 g/mol. Its IUPAC name is diethyl 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 101413948 |
| Molecular Formula | C22H22F2O5 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | diethyl 2-[(1R)-1,3-bis(4-fluorophenyl)-3-oxopropyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](CC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F2O5/c1-3-28-21(26)20(22(27)29-4-2)18(14-5-9-16(23)10-6-14)13-19(25)15-7-11-17(24)12-8-15/h5-12,18,20H,3-4,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZVFNXDSZELKKJO-SFHVURJKSA-N |
| XLogP | 4.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|