C19H17FN2O7 — CID 124826684
ethyl (2R,3R)-3-(4-fluorophenyl)-2-nitro-5-(4-nitrophenyl)-5-oxopentanoate (PubChem CID 124826684) has the molecular formula C19H17FN2O7 and a molecular weight of 404.35 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(4-fluorophenyl)-2-nitro-5-(4-nitrophenyl)-5-oxopentanoate.
| Compound Name | ethyl (2R,3R)-3-(4-fluorophenyl)-2-nitro-5-(4-nitrophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 124826684 |
| Molecular Formula | C19H17FN2O7 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethyl (2R,3R)-3-(4-fluorophenyl)-2-nitro-5-(4-nitrophenyl)-5-oxopentanoate |
| SMILES | CCOC(=O)[C@@H]([C@H](CC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(F)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H17FN2O7/c1-2-29-19(24)18(22(27)28)16(12-3-7-14(20)8-4-12)11-17(23)13-5-9-15(10-6-13)21(25)26/h3-10,16,18H,2,11H2,1H3/t16-,18-/m1/s1 |
| InChIKey | RWUFAFRFQORUPR-SJLPKXTDSA-N |
| XLogP | 3.30 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|