C21H27NO10 — CID 16744629
tetraethyl 2-(4-nitrophenyl)propane-1,1,3,3-tetracarboxylate (PubChem CID 16744629) has the molecular formula C21H27NO10 and a molecular weight of 453.44 g/mol. Its IUPAC name is tetraethyl 2-(4-nitrophenyl)propane-1,1,3,3-tetracarboxylate.
| Compound Name | tetraethyl 2-(4-nitrophenyl)propane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 16744629 |
| Molecular Formula | C21H27NO10 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | tetraethyl 2-(4-nitrophenyl)propane-1,1,3,3-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(c1ccc([N+](=O)[O-])cc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H27NO10/c1-5-29-18(23)16(19(24)30-6-2)15(13-9-11-14(12-10-13)22(27)28)17(20(25)31-7-3)21(26)32-8-4/h9-12,15-17H,5-8H2,1-4H3 |
| InChIKey | SGYUBTVCLVPOCT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|