C22H21ClN2O6 — CID 102136983
diethyl 2-[(1R,2R)-1-(3-chlorophenyl)-2-cyano-2-(4-nitrophenyl)ethyl]propanedioate (PubChem CID 102136983) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-1-(3-chlorophenyl)-2-cyano-2-(4-nitrophenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R)-1-(3-chlorophenyl)-2-cyano-2-(4-nitrophenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 102136983 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | diethyl 2-[(1R,2R)-1-(3-chlorophenyl)-2-cyano-2-(4-nitrophenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](c1cccc(Cl)c1)[C@@H](C#N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21ClN2O6/c1-3-30-21(26)20(22(27)31-4-2)19(15-6-5-7-16(23)12-15)18(13-24)14-8-10-17(11-9-14)25(28)29/h5-12,18-20H,3-4H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | MJCIRLUQEHRUAY-RBUKOAKNSA-N |
| XLogP | 4.38 |
| TPSA | 119.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|