C23H21FN2O4 — CID 102136990
diethyl 2-[(1R,2R)-2-cyano-2-(4-cyanophenyl)-1-(3-fluorophenyl)ethyl]propanedioate (PubChem CID 102136990) has the molecular formula C23H21FN2O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-cyano-2-(4-cyanophenyl)-1-(3-fluorophenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R)-2-cyano-2-(4-cyanophenyl)-1-(3-fluorophenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 102136990 |
| Molecular Formula | C23H21FN2O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-cyano-2-(4-cyanophenyl)-1-(3-fluorophenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](c1cccc(F)c1)[C@@H](C#N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H21FN2O4/c1-3-29-22(27)21(23(28)30-4-2)20(17-6-5-7-18(24)12-17)19(14-26)16-10-8-15(13-25)9-11-16/h5-12,19-21H,3-4H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | SHSYYZKECTXXRE-VQTJNVASSA-N |
| XLogP | 3.83 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|