C11H13FO4 — CID 171865537
ethyl 3-(3-fluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 171865537) has the molecular formula C11H13FO4 and a molecular weight of 228.22 g/mol. Its IUPAC name is ethyl 3-(3-fluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-fluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865537 |
| Molecular Formula | C11H13FO4 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | ethyl 3-(3-fluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FO4/c1-2-16-11(15)10(14)9(13)7-4-3-5-8(12)6-7/h3-6,9-10,13-14H,2H2,1H3 |
| InChIKey | RCTMZTRNJZCTMX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |