C13H15FO6 — CID 171866654
methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate (PubChem CID 171866654) has the molecular formula C13H15FO6 and a molecular weight of 286.26 g/mol. Its IUPAC name is methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate.
| Compound Name | methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate |
|---|---|
| PubChem CID | 171866654 |
| Molecular Formula | C13H15FO6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc(F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H15FO6/c1-3-20-13(18)11(16)10(15)7-4-8(12(17)19-2)6-9(14)5-7/h4-6,10-11,15-16H,3H2,1-2H3 |
| InChIKey | PAXGLTDIPFMCEN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |