methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate

C13H15FO6 — CID 171866654

IUPACmethyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate
SMILESCCOC(=O)C(O)C(O)c1cc(F)cc(C(=O)OC)c1
InChIInChI=1S/C13H15FO6/c1-3-20-13(18)11(16)10(15)7-4-8(12(17)19-2)6-9(14)5-7/h4-6,10-11,15-16H,3H2,1-2H3
InChIKeyPAXGLTDIPFMCEN-UHFFFAOYSA-N
MW286.26 g/mol
LogP0.57
Rot. Bonds5

About methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate

methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate (PubChem CID 171866654) has the molecular formula C13H15FO6 and a molecular weight of 286.26 g/mol. Its IUPAC name is methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate.

Molecular Properties

Compound Namemethyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate
PubChem CID171866654
Molecular FormulaC13H15FO6
Molecular Weight286.26 g/mol
Exact Mass286.09
IUPAC Namemethyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate
SMILESCCOC(=O)C(O)C(O)c1cc(F)cc(C(=O)OC)c1
InChIInChI=1S/C13H15FO6/c1-3-20-13(18)11(16)10(15)7-4-8(12(17)19-2)6-9(14)5-7/h4-6,10-11,15-16H,3H2,1-2H3
InChIKeyPAXGLTDIPFMCEN-UHFFFAOYSA-N
XLogP0.57
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.26
LogP ≤ 50.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate?
The IUPAC name of methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate (CID 171866654) is methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate.
What is the SMILES notation for methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate?
The canonical SMILES for methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate is CCOC(=O)C(O)C(O)c1cc(F)cc(C(=O)OC)c1.
What is the InChIKey of methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate?
The InChIKey is PAXGLTDIPFMCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO6/c1-3-20-13(18)11(16)10(15)7-4-8(12(17)19-2)6-9(14)5-7/h4-6,10-11,15-16H,3H2,1-2H3.
What are the key properties of methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate?
methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate has a molecular weight of 286.26 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-5-fluorobenzoate is sourced from PubChem (CID 171866654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).