methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate

C14H18O6 — CID 171866670

IUPACmethyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate
SMILESCCOC(=O)C(O)C(O)c1ccc(C(=O)OC)cc1C
InChIInChI=1S/C14H18O6/c1-4-20-14(18)12(16)11(15)10-6-5-9(7-8(10)2)13(17)19-3/h5-7,11-12,15-16H,4H2,1-3H3
InChIKeyHSMZEIWCLFMJEB-UHFFFAOYSA-N
MW282.29 g/mol
LogP0.74
Rot. Bonds5

About methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate

methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate (PubChem CID 171866670) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate.

Molecular Properties

Compound Namemethyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate
PubChem CID171866670
Molecular FormulaC14H18O6
Molecular Weight282.29 g/mol
Exact Mass282.11
IUPAC Namemethyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate
SMILESCCOC(=O)C(O)C(O)c1ccc(C(=O)OC)cc1C
InChIInChI=1S/C14H18O6/c1-4-20-14(18)12(16)11(15)10-6-5-9(7-8(10)2)13(17)19-3/h5-7,11-12,15-16H,4H2,1-3H3
InChIKeyHSMZEIWCLFMJEB-UHFFFAOYSA-N
XLogP0.74
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.29
LogP ≤ 50.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate?
The IUPAC name of methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate (CID 171866670) is methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate.
What is the SMILES notation for methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate?
The canonical SMILES for methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate is CCOC(=O)C(O)C(O)c1ccc(C(=O)OC)cc1C.
What is the InChIKey of methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate?
The InChIKey is HSMZEIWCLFMJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O6/c1-4-20-14(18)12(16)11(15)10-6-5-9(7-8(10)2)13(17)19-3/h5-7,11-12,15-16H,4H2,1-3H3.
What are the key properties of methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate?
methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate has a molecular weight of 282.29 g/mol, XLogP of 0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-methylbenzoate is sourced from PubChem (CID 171866670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).