C13H18O4 — CID 171865672
ethyl 3-(2,4-dimethylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171865672) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is ethyl 3-(2,4-dimethylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2,4-dimethylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865672 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl 3-(2,4-dimethylphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H18O4/c1-4-17-13(16)12(15)11(14)10-6-5-8(2)7-9(10)3/h5-7,11-12,14-15H,4H2,1-3H3 |
| InChIKey | DXIIYJHVTRRVQP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |