4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid

C12H14O7 — CID 171866460

IUPAC4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid
SMILESCCOC(=O)C(O)C(O)c1ccc(C(=O)O)cc1O
InChIInChI=1S/C12H14O7/c1-2-19-12(18)10(15)9(14)7-4-3-6(11(16)17)5-8(7)13/h3-5,9-10,13-15H,2H2,1H3,(H,16,17)
InChIKeyHMCOHEWKGHBOPL-UHFFFAOYSA-N
MW270.24 g/mol
LogP0.05
Rot. Bonds5

About 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid

4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid (PubChem CID 171866460) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid.

Molecular Properties

Compound Name4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid
PubChem CID171866460
Molecular FormulaC12H14O7
Molecular Weight270.24 g/mol
Exact Mass270.07
IUPAC Name4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid
SMILESCCOC(=O)C(O)C(O)c1ccc(C(=O)O)cc1O
InChIInChI=1S/C12H14O7/c1-2-19-12(18)10(15)9(14)7-4-3-6(11(16)17)5-8(7)13/h3-5,9-10,13-15H,2H2,1H3,(H,16,17)
InChIKeyHMCOHEWKGHBOPL-UHFFFAOYSA-N
XLogP0.05
TPSA124.29 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.24
LogP ≤ 50.05
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid?
The IUPAC name of 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid (CID 171866460) is 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid.
What is the SMILES notation for 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid?
The canonical SMILES for 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid is CCOC(=O)C(O)C(O)c1ccc(C(=O)O)cc1O.
What is the InChIKey of 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid?
The InChIKey is HMCOHEWKGHBOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-2-19-12(18)10(15)9(14)7-4-3-6(11(16)17)5-8(7)13/h3-5,9-10,13-15H,2H2,1H3,(H,16,17).
What are the key properties of 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid?
4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid has a molecular weight of 270.24 g/mol, XLogP of 0.05, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid is sourced from PubChem (CID 171866460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).