C12H14O7 — CID 171866460
4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid (PubChem CID 171866460) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid.
| Compound Name | 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171866460 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-3-hydroxybenzoic acid |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C12H14O7/c1-2-19-12(18)10(15)9(14)7-4-3-6(11(16)17)5-8(7)13/h3-5,9-10,13-15H,2H2,1H3,(H,16,17) |
| InChIKey | HMCOHEWKGHBOPL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |