C14H19NO6 — CID 171867019
ethyl 4-amino-3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)benzoate (PubChem CID 171867019) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 4-amino-3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)benzoate.
| Compound Name | ethyl 4-amino-3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)benzoate |
|---|---|
| PubChem CID | 171867019 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 4-amino-3-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(C(O)C(O)C(=O)OCC)c1 |
| InChI | InChI=1S/C14H19NO6/c1-3-20-13(18)8-5-6-10(15)9(7-8)11(16)12(17)14(19)21-4-2/h5-7,11-12,16-17H,3-4,15H2,1-2H3 |
| InChIKey | MCPQHCMLESCSDC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|