C12H14N2O4 — CID 171871151
ethyl 4-amino-3-(2-cyano-1,2-dihydroxyethyl)benzoate (PubChem CID 171871151) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl 4-amino-3-(2-cyano-1,2-dihydroxyethyl)benzoate.
| Compound Name | ethyl 4-amino-3-(2-cyano-1,2-dihydroxyethyl)benzoate |
|---|---|
| PubChem CID | 171871151 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 4-amino-3-(2-cyano-1,2-dihydroxyethyl)benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(C(O)C(O)C#N)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-2-18-12(17)7-3-4-9(14)8(5-7)11(16)10(15)6-13/h3-5,10-11,15-16H,2,14H2,1H3 |
| InChIKey | QOSRMVSYULYNFP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|