C12H14N2O4S — CID 171866464
ethyl 3-(2-amino-5-thiocyanatophenyl)-2,3-dihydroxypropanoate (PubChem CID 171866464) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl 3-(2-amino-5-thiocyanatophenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2-amino-5-thiocyanatophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866464 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | ethyl 3-(2-amino-5-thiocyanatophenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc(SC#N)ccc1N |
| InChI | InChI=1S/C12H14N2O4S/c1-2-18-12(17)11(16)10(15)8-5-7(19-6-13)3-4-9(8)14/h3-5,10-11,15-16H,2,14H2,1H3 |
| InChIKey | WHLMRFHDOXHRNG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|