4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid

C13H16O7 — CID 171897743

IUPAC4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid
SMILESCCOC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1O
InChIInChI=1S/C13H16O7/c1-2-20-11(16)6-10(15)12(17)8-4-3-7(13(18)19)5-9(8)14/h3-5,10,12,14-15,17H,2,6H2,1H3,(H,18,19)
InChIKeySTOZMRATKFCBNZ-UHFFFAOYSA-N
MW284.26 g/mol
LogP0.44
Rot. Bonds6

About 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid

4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid (PubChem CID 171897743) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid.

Molecular Properties

Compound Name4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid
PubChem CID171897743
Molecular FormulaC13H16O7
Molecular Weight284.26 g/mol
Exact Mass284.09
IUPAC Name4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid
SMILESCCOC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1O
InChIInChI=1S/C13H16O7/c1-2-20-11(16)6-10(15)12(17)8-4-3-7(13(18)19)5-9(8)14/h3-5,10,12,14-15,17H,2,6H2,1H3,(H,18,19)
InChIKeySTOZMRATKFCBNZ-UHFFFAOYSA-N
XLogP0.44
TPSA124.29 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.26
LogP ≤ 50.44
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid?
The IUPAC name of 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid (CID 171897743) is 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid.
What is the SMILES notation for 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid?
The canonical SMILES for 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid is CCOC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1O.
What is the InChIKey of 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid?
The InChIKey is STOZMRATKFCBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7/c1-2-20-11(16)6-10(15)12(17)8-4-3-7(13(18)19)5-9(8)14/h3-5,10,12,14-15,17H,2,6H2,1H3,(H,18,19).
What are the key properties of 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid?
4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid has a molecular weight of 284.26 g/mol, XLogP of 0.44, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid is sourced from PubChem (CID 171897743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).