C13H16O7 — CID 171897743
4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid (PubChem CID 171897743) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid.
| Compound Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171897743 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-hydroxybenzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C13H16O7/c1-2-20-11(16)6-10(15)12(17)8-4-3-7(13(18)19)5-9(8)14/h3-5,10,12,14-15,17H,2,6H2,1H3,(H,18,19) |
| InChIKey | STOZMRATKFCBNZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |