C19H20O5 — CID 171898395
ethyl 4-(2-benzoylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171898395) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is ethyl 4-(2-benzoylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2-benzoylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898395 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 4-(2-benzoylphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O5/c1-2-24-17(21)12-16(20)19(23)15-11-7-6-10-14(15)18(22)13-8-4-3-5-9-13/h3-11,16,19-20,23H,2,12H2,1H3 |
| InChIKey | QZBWAPFRODWTLL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |