C17H20O4 — CID 171898110
ethyl 3,4-dihydroxy-4-(4-methylnaphthalen-1-yl)butanoate (PubChem CID 171898110) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(4-methylnaphthalen-1-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(4-methylnaphthalen-1-yl)butanoate |
|---|---|
| PubChem CID | 171898110 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(4-methylnaphthalen-1-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C17H20O4/c1-3-21-16(19)10-15(18)17(20)14-9-8-11(2)12-6-4-5-7-13(12)14/h4-9,15,17-18,20H,3,10H2,1-2H3 |
| InChIKey | XZYRNMMXQGEUMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |