C16H19NO2 — CID 171228563
ethyl (3S)-3-amino-3-(4-methylnaphthalen-1-yl)propanoate (PubChem CID 171228563) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(4-methylnaphthalen-1-yl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(4-methylnaphthalen-1-yl)propanoate |
|---|---|
| PubChem CID | 171228563 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | ethyl (3S)-3-amino-3-(4-methylnaphthalen-1-yl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C16H19NO2/c1-3-19-16(18)10-15(17)14-9-8-11(2)12-6-4-5-7-13(12)14/h4-9,15H,3,10,17H2,1-2H3/t15-/m0/s1 |
| InChIKey | UPPSFOATEGWRPZ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |