C15H20ClN — CID 171228525
(1S)-1-(4-methylnaphthalen-1-yl)butan-1-amine;hydrochloride (PubChem CID 171228525) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is (1S)-1-(4-methylnaphthalen-1-yl)butan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4-methylnaphthalen-1-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228525 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (1S)-1-(4-methylnaphthalen-1-yl)butan-1-amine;hydrochloride |
| SMILES | CCC[C@H](N)c1ccc(C)c2ccccc12.Cl |
| InChI | InChI=1S/C15H19N.ClH/c1-3-6-15(16)14-10-9-11(2)12-7-4-5-8-13(12)14;/h4-5,7-10,15H,3,6,16H2,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | RCRSBHBFQOMQAK-RSAXXLAASA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |