C16H20ClN — CID 171208948
(1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethanamine;hydrochloride (PubChem CID 171208948) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is (1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethanamine;hydrochloride.
| Compound Name | (1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171208948 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CC2CC2)c2ccccc12.Cl |
| InChI | InChI=1S/C16H19N.ClH/c1-11-6-9-15(16(17)10-12-7-8-12)14-5-3-2-4-13(11)14;/h2-6,9,12,16H,7-8,10,17H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | BOSPSZIVWLLWPX-PKLMIRHRSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |