C20H28Cl2N2 — CID 171292446
1-[(1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethyl]piperazine;dihydrochloride (PubChem CID 171292446) has the molecular formula C20H28Cl2N2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 1-[(1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292446 |
| Molecular Formula | C20H28Cl2N2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(1R)-2-cyclopropyl-1-(4-methylnaphthalen-1-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@@H](CC2CC2)N2CCNCC2)c2ccccc12.Cl.Cl |
| InChI | InChI=1S/C20H26N2.2ClH/c1-15-6-9-19(18-5-3-2-4-17(15)18)20(14-16-7-8-16)22-12-10-21-11-13-22;;/h2-6,9,16,20-21H,7-8,10-14H2,1H3;2*1H/t20-;;/m1../s1 |
| InChIKey | IGHJIWQIPOEUPU-FAVHNTAZSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |