C12H17BrClN — CID 171223427
(1S)-1-(5-bromo-2-methylphenyl)-2-cyclopropylethanamine;hydrochloride (PubChem CID 171223427) has the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. Its IUPAC name is (1S)-1-(5-bromo-2-methylphenyl)-2-cyclopropylethanamine;hydrochloride.
| Compound Name | (1S)-1-(5-bromo-2-methylphenyl)-2-cyclopropylethanamine;hydrochloride |
|---|---|
| PubChem CID | 171223427 |
| Molecular Formula | C12H17BrClN |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (1S)-1-(5-bromo-2-methylphenyl)-2-cyclopropylethanamine;hydrochloride |
| SMILES | Cc1ccc(Br)cc1[C@@H](N)CC1CC1.Cl |
| InChI | InChI=1S/C12H16BrN.ClH/c1-8-2-5-10(13)7-11(8)12(14)6-9-3-4-9;/h2,5,7,9,12H,3-4,6,14H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | ZOLNHCZWFPIACW-YDALLXLXSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |