C11H15BrClN — CID 171219224
(1S)-1-(4-bromophenyl)-2-cyclopropylethanamine;hydrochloride (PubChem CID 171219224) has the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-2-cyclopropylethanamine;hydrochloride.
| Compound Name | (1S)-1-(4-bromophenyl)-2-cyclopropylethanamine;hydrochloride |
|---|---|
| PubChem CID | 171219224 |
| Molecular Formula | C11H15BrClN |
| Molecular Weight | 276.60 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-2-cyclopropylethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CC1CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrN.ClH/c12-10-5-3-9(4-6-10)11(13)7-8-1-2-8;/h3-6,8,11H,1-2,7,13H2;1H/t11-;/m0./s1 |
| InChIKey | SRYUBIOFRNUREV-MERQFXBCSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |