C12H18N2 — CID 150978200
(1S)-1-[4-(aminomethyl)phenyl]-2-cyclopropylethanamine (PubChem CID 150978200) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (1S)-1-[4-(aminomethyl)phenyl]-2-cyclopropylethanamine.
| Compound Name | (1S)-1-[4-(aminomethyl)phenyl]-2-cyclopropylethanamine |
|---|---|
| PubChem CID | 150978200 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (1S)-1-[4-(aminomethyl)phenyl]-2-cyclopropylethanamine |
| SMILES | NCc1ccc([C@@H](N)CC2CC2)cc1 |
| InChI | InChI=1S/C12H18N2/c13-8-10-3-5-11(6-4-10)12(14)7-9-1-2-9/h3-6,9,12H,1-2,7-8,13-14H2/t12-/m0/s1 |
| InChIKey | LPNPAFJMXMTACB-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |